C14H18ClF3N2OS — CID 119936226
N-[2-methyl-3-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119936226) has the molecular formula C14H18ClF3N2OS and a molecular weight of 354.83 g/mol. Its IUPAC name is N-[2-methyl-3-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[2-methyl-3-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119936226 |
| Molecular Formula | C14H18ClF3N2OS |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[2-methyl-3-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | Cc1c(NC(=O)CC2CSCCN2)cccc1C(F)(F)F.Cl |
| InChI | InChI=1S/C14H17F3N2OS.ClH/c1-9-11(14(15,16)17)3-2-4-12(9)19-13(20)7-10-8-21-6-5-18-10;/h2-4,10,18H,5-8H2,1H3,(H,19,20);1H |
| InChIKey | MBDPJNZABYMVDJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |