C16H26ClN3O3S2 — CID 119939738
N-[4-(butylsulfonylamino)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119939738) has the molecular formula C16H26ClN3O3S2 and a molecular weight of 407.99 g/mol. Its IUPAC name is N-[4-(butylsulfonylamino)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[4-(butylsulfonylamino)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119939738 |
| Molecular Formula | C16H26ClN3O3S2 |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[4-(butylsulfonylamino)phenyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | CCCCS(=O)(=O)Nc1ccc(NC(=O)CC2CSCCN2)cc1.Cl |
| InChI | InChI=1S/C16H25N3O3S2.ClH/c1-2-3-10-24(21,22)19-14-6-4-13(5-7-14)18-16(20)11-15-12-23-9-8-17-15;/h4-7,15,17,19H,2-3,8-12H2,1H3,(H,18,20);1H |
| InChIKey | IEYSVHFGQYVHPD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |