C22H24BrCl2N3O4 — CID 5138659
N'-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-N-(2,3-dichlorophenyl)propanediamide (PubChem CID 5138659) has the molecular formula C22H24BrCl2N3O4 and a molecular weight of 545.26 g/mol. Its IUPAC name is N'-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-N-(2,3-dichlorophenyl)propanediamide.
| Compound Name | N'-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-N-(2,3-dichlorophenyl)propanediamide |
|---|---|
| PubChem CID | 5138659 |
| Molecular Formula | C22H24BrCl2N3O4 |
| Molecular Weight | 545.26 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | N'-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-N-(2,3-dichlorophenyl)propanediamide |
| SMILES | CCCCOc1c(Br)cc(C=NNC(=O)CC(=O)Nc2cccc(Cl)c2Cl)cc1OCC |
| InChI | InChI=1S/C22H24BrCl2N3O4/c1-3-5-9-32-22-15(23)10-14(11-18(22)31-4-2)13-26-28-20(30)12-19(29)27-17-8-6-7-16(24)21(17)25/h6-8,10-11,13H,3-5,9,12H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | WNHTXXIZWJVGBK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.26 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|