C23H27BrClN3O4 — CID 4660624
N'-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-N-(3-chlorophenyl)butanediamide (PubChem CID 4660624) has the molecular formula C23H27BrClN3O4 and a molecular weight of 524.84 g/mol. Its IUPAC name is N'-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-N-(3-chlorophenyl)butanediamide.
| Compound Name | N'-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-N-(3-chlorophenyl)butanediamide |
|---|---|
| PubChem CID | 4660624 |
| Molecular Formula | C23H27BrClN3O4 |
| Molecular Weight | 524.84 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | N'-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-N-(3-chlorophenyl)butanediamide |
| SMILES | CCCCOc1c(Br)cc(C=NNC(=O)CCC(=O)Nc2cccc(Cl)c2)cc1OCC |
| InChI | InChI=1S/C23H27BrClN3O4/c1-3-5-11-32-23-19(24)12-16(13-20(23)31-4-2)15-26-28-22(30)10-9-21(29)27-18-8-6-7-17(25)14-18/h6-8,12-15H,3-5,9-11H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | FIENUOXVURJNNE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.84 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|