C23H25Cl2IN4O5 — CID 126158711
N-[(2S)-butan-2-yl]-N'-[(Z)-[4-[2-(2,4-dichloroanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]oxamide (PubChem CID 126158711) has the molecular formula C23H25Cl2IN4O5 and a molecular weight of 635.29 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N'-[(Z)-[4-[2-(2,4-dichloroanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]oxamide.
| Compound Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[4-[2-(2,4-dichloroanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126158711 |
| Molecular Formula | C23H25Cl2IN4O5 |
| Molecular Weight | 635.29 g/mol |
| Exact Mass | 634.02 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[4-[2-(2,4-dichloroanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]methylideneamino]oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)N[C@@H](C)CC)cc(I)c1OCC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H25Cl2IN4O5/c1-4-13(3)28-22(32)23(33)30-27-11-14-8-17(26)21(19(9-14)34-5-2)35-12-20(31)29-18-7-6-15(24)10-16(18)25/h6-11,13H,4-5,12H2,1-3H3,(H,28,32)(H,29,31)(H,30,33)/b27-11-/t13-/m0/s1 |
| InChIKey | JUKRBXSCVCWVEE-KCENJROVSA-N |
| XLogP | 4.38 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|