C22H31BrN4O7 — CID 126172251
N'-[(Z)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 126172251) has the molecular formula C22H31BrN4O7 and a molecular weight of 543.42 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-[(Z)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 126172251 |
| Molecular Formula | C22H31BrN4O7 |
| Molecular Weight | 543.42 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | N'-[(Z)-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NCCCOC(C)C)cc(Br)c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H31BrN4O7/c1-15(2)33-8-4-5-24-21(29)22(30)26-25-13-16-11-17(23)20(18(12-16)31-3)34-14-19(28)27-6-9-32-10-7-27/h11-13,15H,4-10,14H2,1-3H3,(H,24,29)(H,26,30)/b25-13- |
| InChIKey | BTIOKXAAIAUFFC-MXAYSNPKSA-N |
| XLogP | 1.08 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|