C26H33ClN4O6 — CID 126268764
N'-[(Z)-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 126268764) has the molecular formula C26H33ClN4O6 and a molecular weight of 533.03 g/mol. Its IUPAC name is N'-[(Z)-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-[(Z)-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 126268764 |
| Molecular Formula | C26H33ClN4O6 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N'-[(Z)-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)NCCCOC(C)C)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C26H33ClN4O6/c1-16(2)36-10-6-9-28-25(33)26(34)31-29-14-19-12-20(27)24(22(13-19)35-5)37-15-23(32)30-21-8-7-17(3)11-18(21)4/h7-8,11-14,16H,6,9-10,15H2,1-5H3,(H,28,33)(H,30,32)(H,31,34)/b29-14- |
| InChIKey | JAOBMPQBMIGSKX-NUJZUDFISA-N |
| XLogP | 3.36 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|