C25H30ClFN4O6 — CID 126168058
N'-[(Z)-[3-chloro-5-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide (PubChem CID 126168058) has the molecular formula C25H30ClFN4O6 and a molecular weight of 536.99 g/mol. Its IUPAC name is N'-[(Z)-[3-chloro-5-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide.
| Compound Name | N'-[(Z)-[3-chloro-5-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
|---|---|
| PubChem CID | 126168058 |
| Molecular Formula | C25H30ClFN4O6 |
| Molecular Weight | 536.99 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | N'-[(Z)-[3-chloro-5-ethoxy-4-[2-(2-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(3-propan-2-yloxypropyl)oxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(=O)NCCCOC(C)C)cc(Cl)c1OCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C25H30ClFN4O6/c1-4-35-21-13-17(14-29-31-25(34)24(33)28-10-7-11-36-16(2)3)12-18(26)23(21)37-15-22(32)30-20-9-6-5-8-19(20)27/h5-6,8-9,12-14,16H,4,7,10-11,15H2,1-3H3,(H,28,33)(H,30,32)(H,31,34)/b29-14- |
| InChIKey | ZGQMLRNPRNKKPD-NUJZUDFISA-N |
| XLogP | 3.28 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.99 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|