C28H29ClN4O5 — CID 126171394
N'-[(Z)-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide (PubChem CID 126171394) has the molecular formula C28H29ClN4O5 and a molecular weight of 537.02 g/mol. Its IUPAC name is N'-[(Z)-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 126171394 |
| Molecular Formula | C28H29ClN4O5 |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | N'-[(Z)-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-(2,6-dimethylphenyl)oxamide |
| SMILES | COc1cc(/C=N\NC(=O)C(=O)Nc2c(C)cccc2C)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C28H29ClN4O5/c1-16-9-10-22(19(4)11-16)31-24(34)15-38-26-21(29)12-20(13-23(26)37-5)14-30-33-28(36)27(35)32-25-17(2)7-6-8-18(25)3/h6-14H,15H2,1-5H3,(H,31,34)(H,32,35)(H,33,36)/b30-14- |
| InChIKey | SQKCZQCVNUQDHD-CPDSRJINSA-N |
| XLogP | 4.69 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|