C16H18BrNO6 — CID 171146647
3-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enoic acid (PubChem CID 171146647) has the molecular formula C16H18BrNO6 and a molecular weight of 400.23 g/mol. Its IUPAC name is 3-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171146647 |
| Molecular Formula | C16H18BrNO6 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 3-[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)cc(Br)c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H18BrNO6/c1-22-13-9-11(2-3-15(20)21)8-12(17)16(13)24-10-14(19)18-4-6-23-7-5-18/h2-3,8-9H,4-7,10H2,1H3,(H,20,21) |
| InChIKey | LRMNOVXQGDSJDW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|