C18H17BrN4O5 — CID 135554209
N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(4-carbamoylphenyl)oxamide (PubChem CID 135554209) has the molecular formula C18H17BrN4O5 and a molecular weight of 449.26 g/mol. Its IUPAC name is N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(4-carbamoylphenyl)oxamide.
| Compound Name | N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(4-carbamoylphenyl)oxamide |
|---|---|
| PubChem CID | 135554209 |
| Molecular Formula | C18H17BrN4O5 |
| Molecular Weight | 449.26 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | N'-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-N-(4-carbamoylphenyl)oxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C(=O)Nc2ccc(C(N)=O)cc2)cc(Br)c1O |
| InChI | InChI=1S/C18H17BrN4O5/c1-2-28-14-8-10(7-13(19)15(14)24)9-21-23-18(27)17(26)22-12-5-3-11(4-6-12)16(20)25/h3-9,24H,2H2,1H3,(H2,20,25)(H,22,26)(H,23,27)/b21-9+ |
| InChIKey | GCHGPWVCQWKFTK-ZVBGSRNCSA-N |
| XLogP | 1.74 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|