C21H16ClN3O6 — CID 6185657
4-[[4-[(2Z)-2-[(7-chloro-4-oxochromen-3-yl)methylidene]hydrazinyl]-4-oxobutanoyl]amino]benzoic acid (PubChem CID 6185657) has the molecular formula C21H16ClN3O6 and a molecular weight of 441.83 g/mol. Its IUPAC name is 4-[[4-[(2Z)-2-[(7-chloro-4-oxochromen-3-yl)methylidene]hydrazinyl]-4-oxobutanoyl]amino]benzoic acid.
| Compound Name | 4-[[4-[(2Z)-2-[(7-chloro-4-oxochromen-3-yl)methylidene]hydrazinyl]-4-oxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 6185657 |
| Molecular Formula | C21H16ClN3O6 |
| Molecular Weight | 441.83 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 4-[[4-[(2Z)-2-[(7-chloro-4-oxochromen-3-yl)methylidene]hydrazinyl]-4-oxobutanoyl]amino]benzoic acid |
| SMILES | O=C(CCC(=O)Nc1ccc(C(=O)O)cc1)N/N=C\c1coc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H16ClN3O6/c22-14-3-6-16-17(9-14)31-11-13(20(16)28)10-23-25-19(27)8-7-18(26)24-15-4-1-12(2-5-15)21(29)30/h1-6,9-11H,7-8H2,(H,24,26)(H,25,27)(H,29,30)/b23-10- |
| InChIKey | TZCZAIFUCNEKSA-RMORIDSASA-N |
| XLogP | 3.01 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.83 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|