C20H15FN4O6 — CID 71951300
N'-[(6-fluoro-4-oxochromen-3-yl)methylideneamino]-N-(2-nitrophenyl)butanediamide (PubChem CID 71951300) has the molecular formula C20H15FN4O6 and a molecular weight of 426.36 g/mol. Its IUPAC name is N'-[(6-fluoro-4-oxochromen-3-yl)methylideneamino]-N-(2-nitrophenyl)butanediamide.
| Compound Name | N'-[(6-fluoro-4-oxochromen-3-yl)methylideneamino]-N-(2-nitrophenyl)butanediamide |
|---|---|
| PubChem CID | 71951300 |
| Molecular Formula | C20H15FN4O6 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N'-[(6-fluoro-4-oxochromen-3-yl)methylideneamino]-N-(2-nitrophenyl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccccc1[N+](=O)[O-])NN=Cc1coc2ccc(F)cc2c1=O |
| InChI | InChI=1S/C20H15FN4O6/c21-13-5-6-17-14(9-13)20(28)12(11-31-17)10-22-24-19(27)8-7-18(26)23-15-3-1-2-4-16(15)25(29)30/h1-6,9-11H,7-8H2,(H,23,26)(H,24,27) |
| InChIKey | YIWDHNHQXPWJGN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|