C21H18FN3O4 — CID 6899506
N'-[(E)-(6-fluoro-4-oxochromen-3-yl)methylideneamino]-N-(4-methylphenyl)butanediamide (PubChem CID 6899506) has the molecular formula C21H18FN3O4 and a molecular weight of 395.39 g/mol. Its IUPAC name is N'-[(E)-(6-fluoro-4-oxochromen-3-yl)methylideneamino]-N-(4-methylphenyl)butanediamide.
| Compound Name | N'-[(E)-(6-fluoro-4-oxochromen-3-yl)methylideneamino]-N-(4-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 6899506 |
| Molecular Formula | C21H18FN3O4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N'-[(E)-(6-fluoro-4-oxochromen-3-yl)methylideneamino]-N-(4-methylphenyl)butanediamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)N/N=C/c2coc3ccc(F)cc3c2=O)cc1 |
| InChI | InChI=1S/C21H18FN3O4/c1-13-2-5-16(6-3-13)24-19(26)8-9-20(27)25-23-11-14-12-29-18-7-4-15(22)10-17(18)21(14)28/h2-7,10-12H,8-9H2,1H3,(H,24,26)(H,25,27)/b23-11+ |
| InChIKey | FMWCGRLXKGWWNZ-FOKLQQMPSA-N |
| XLogP | 3.11 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|