C16H20N3O3S+ — CID 4920719
[1-[2-[(6-methyl-4-oxochromen-3-yl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]azanium (PubChem CID 4920719) has the molecular formula C16H20N3O3S+ and a molecular weight of 334.42 g/mol. Its IUPAC name is [1-[2-[(6-methyl-4-oxochromen-3-yl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]azanium.
| Compound Name | [1-[2-[(6-methyl-4-oxochromen-3-yl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]azanium |
|---|---|
| PubChem CID | 4920719 |
| Molecular Formula | C16H20N3O3S+ |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [1-[2-[(6-methyl-4-oxochromen-3-yl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]azanium |
| SMILES | CSCCC([NH3+])C(=O)NN=Cc1coc2ccc(C)cc2c1=O |
| InChI | InChI=1S/C16H19N3O3S/c1-10-3-4-14-12(7-10)15(20)11(9-22-14)8-18-19-16(21)13(17)5-6-23-2/h3-4,7-9,13H,5-6,17H2,1-2H3,(H,19,21)/p+1 |
| InChIKey | JGIBALQMPJKKFZ-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|