C29H20FN3O3 — CID 44725052
2-(4-fluorophenyl)-N-[(E)-(6-methyl-4-oxochromen-3-yl)methylideneamino]-6-phenylpyridine-4-carboxamide (PubChem CID 44725052) has the molecular formula C29H20FN3O3 and a molecular weight of 477.50 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(E)-(6-methyl-4-oxochromen-3-yl)methylideneamino]-6-phenylpyridine-4-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[(E)-(6-methyl-4-oxochromen-3-yl)methylideneamino]-6-phenylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 44725052 |
| Molecular Formula | C29H20FN3O3 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(E)-(6-methyl-4-oxochromen-3-yl)methylideneamino]-6-phenylpyridine-4-carboxamide |
| SMILES | Cc1ccc2occ(/C=N/NC(=O)c3cc(-c4ccccc4)nc(-c4ccc(F)cc4)c3)c(=O)c2c1 |
| InChI | InChI=1S/C29H20FN3O3/c1-18-7-12-27-24(13-18)28(34)22(17-36-27)16-31-33-29(35)21-14-25(19-5-3-2-4-6-19)32-26(15-21)20-8-10-23(30)11-9-20/h2-17H,1H3,(H,33,35)/b31-16+ |
| InChIKey | GXXJHYBHJMUIMH-WCMJOSRZSA-N |
| XLogP | 5.73 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|