C27H23N3O — CID 44721589
N-[(E)-benzylideneamino]-2,6-bis(4-methylphenyl)pyridine-4-carboxamide (PubChem CID 44721589) has the molecular formula C27H23N3O and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2,6-bis(4-methylphenyl)pyridine-4-carboxamide.
| Compound Name | N-[(E)-benzylideneamino]-2,6-bis(4-methylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 44721589 |
| Molecular Formula | C27H23N3O |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[(E)-benzylideneamino]-2,6-bis(4-methylphenyl)pyridine-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)N/N=C/c3ccccc3)cc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H23N3O/c1-19-8-12-22(13-9-19)25-16-24(17-26(29-25)23-14-10-20(2)11-15-23)27(31)30-28-18-21-6-4-3-5-7-21/h3-18H,1-2H3,(H,30,31)/b28-18+ |
| InChIKey | TVILOUIQHMIDFM-MTDXEUNCSA-N |
| XLogP | 5.80 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|