C19H17N3O2 — CID 70622767
4-methyl-N-[(4-methylphenyl)methylideneamino]-2-phenyl-1,3-oxazole-5-carboxamide (PubChem CID 70622767) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-methyl-N-[(4-methylphenyl)methylideneamino]-2-phenyl-1,3-oxazole-5-carboxamide.
| Compound Name | 4-methyl-N-[(4-methylphenyl)methylideneamino]-2-phenyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 70622767 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 4-methyl-N-[(4-methylphenyl)methylideneamino]-2-phenyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ccc(C=NNC(=O)c2oc(-c3ccccc3)nc2C)cc1 |
| InChI | InChI=1S/C19H17N3O2/c1-13-8-10-15(11-9-13)12-20-22-18(23)17-14(2)21-19(24-17)16-6-4-3-5-7-16/h3-12H,1-2H3,(H,22,23) |
| InChIKey | IRNTWAXBUGBLFK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|