C14H18ClN3O2 — CID 119504426
4-methyl-N-[2-(methylamino)ethyl]-2-phenyl-1,3-oxazole-5-carboxamide;hydrochloride (PubChem CID 119504426) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 4-methyl-N-[2-(methylamino)ethyl]-2-phenyl-1,3-oxazole-5-carboxamide;hydrochloride.
| Compound Name | 4-methyl-N-[2-(methylamino)ethyl]-2-phenyl-1,3-oxazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119504426 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-methyl-N-[2-(methylamino)ethyl]-2-phenyl-1,3-oxazole-5-carboxamide;hydrochloride |
| SMILES | CNCCNC(=O)c1oc(-c2ccccc2)nc1C.Cl |
| InChI | InChI=1S/C14H17N3O2.ClH/c1-10-12(13(18)16-9-8-15-2)19-14(17-10)11-6-4-3-5-7-11;/h3-7,15H,8-9H2,1-2H3,(H,16,18);1H |
| InChIKey | ZQNBPFVCNITBAF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|