C17H10ClKN2O2S2 — CID 23686227
potassium N-[4-[(6-chloro-4-oxochromen-3-yl)methylideneamino]phenyl]carbamodithioate (PubChem CID 23686227) has the molecular formula C17H10ClKN2O2S2 and a molecular weight of 412.96 g/mol. Its IUPAC name is potassium N-[4-[(6-chloro-4-oxochromen-3-yl)methylideneamino]phenyl]carbamodithioate.
| Compound Name | potassium N-[4-[(6-chloro-4-oxochromen-3-yl)methylideneamino]phenyl]carbamodithioate |
|---|---|
| PubChem CID | 23686227 |
| Molecular Formula | C17H10ClKN2O2S2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 411.95 |
| IUPAC Name | potassium N-[4-[(6-chloro-4-oxochromen-3-yl)methylideneamino]phenyl]carbamodithioate |
| SMILES | O=c1c(/C=N/c2ccc(NC(=S)[S-])cc2)coc2ccc(Cl)cc12.[K+] |
| InChI | InChI=1S/C17H11ClN2O2S2.K/c18-11-1-6-15-14(7-11)16(21)10(9-22-15)8-19-12-2-4-13(5-3-12)20-17(23)24;/h1-9H,(H2,20,23,24);/q;+1/p-1/b19-8+; |
| InChIKey | ZGYYJXLVFUCQOG-BTSUEJIHSA-M |
| XLogP | 1.44 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|