C25H17F6N7O4 — CID 135400285
2-[(E)-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-(N-phenylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 135400285) has the molecular formula C25H17F6N7O4 and a molecular weight of 593.44 g/mol. Its IUPAC name is 2-[(E)-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-(N-phenylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 2-[(E)-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-(N-phenylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135400285 |
| Molecular Formula | C25H17F6N7O4 |
| Molecular Weight | 593.44 g/mol |
| Exact Mass | 593.12 |
| IUPAC Name | 2-[(E)-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-(N-phenylanilino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cccc(/C=N/Nc2nc(OC(C(F)(F)F)C(F)(F)F)nc(N(c3ccccc3)c3ccccc3)n2)c1O |
| InChI | InChI=1S/C25H17F6N7O4/c26-24(27,28)20(25(29,30)31)42-23-34-21(36-32-14-15-8-7-13-18(19(15)39)38(40)41)33-22(35-23)37(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,20,39H,(H,33,34,35,36)/b32-14+ |
| InChIKey | IDZJESXQUULSIQ-HIWRWHBISA-N |
| XLogP | 6.27 |
| TPSA | 138.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.44 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|