C23H29BrF6N6O2 — CID 136695903
4-bromo-2-[(Z)-[[4-(dipentylamino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 136695903) has the molecular formula C23H29BrF6N6O2 and a molecular weight of 615.42 g/mol. Its IUPAC name is 4-bromo-2-[(Z)-[[4-(dipentylamino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-[(Z)-[[4-(dipentylamino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136695903 |
| Molecular Formula | C23H29BrF6N6O2 |
| Molecular Weight | 615.42 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | 4-bromo-2-[(Z)-[[4-(dipentylamino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | CCCCCN(CCCCC)c1nc(N/N=C\c2cc(Br)ccc2O)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C23H29BrF6N6O2/c1-3-5-7-11-36(12-8-6-4-2)20-32-19(35-31-14-15-13-16(24)9-10-17(15)37)33-21(34-20)38-18(22(25,26)27)23(28,29)30/h9-10,13-14,18,37H,3-8,11-12H2,1-2H3,(H,32,33,34,35)/b31-14- |
| InChIKey | WUZMWORUHHVOCM-AQLQTECXSA-N |
| XLogP | 6.84 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.42 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|