C19H12BrF6N7O3 — CID 6252997
2-N-[(Z)-(4-bromophenyl)methylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 6252997) has the molecular formula C19H12BrF6N7O3 and a molecular weight of 580.24 g/mol. Its IUPAC name is 2-N-[(Z)-(4-bromophenyl)methylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-(4-bromophenyl)methylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6252997 |
| Molecular Formula | C19H12BrF6N7O3 |
| Molecular Weight | 580.24 g/mol |
| Exact Mass | 579.01 |
| IUPAC Name | 2-N-[(Z)-(4-bromophenyl)methylideneamino]-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-nitrophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(N/N=C\c3ccc(Br)cc3)nc(OC(C(F)(F)F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H12BrF6N7O3/c20-11-3-1-10(2-4-11)9-27-32-16-29-15(28-12-5-7-13(8-6-12)33(34)35)30-17(31-16)36-14(18(21,22)23)19(24,25)26/h1-9,14H,(H2,28,29,30,31,32)/b27-9- |
| InChIKey | VKJDGCXRDVGHCW-WPDGFUPNSA-N |
| XLogP | 5.60 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.24 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|