C19H12BrF6N7O4 — CID 135606257
2-[(E)-[[4-(4-bromoanilino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol (PubChem CID 135606257) has the molecular formula C19H12BrF6N7O4 and a molecular weight of 596.24 g/mol. Its IUPAC name is 2-[(E)-[[4-(4-bromoanilino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol.
| Compound Name | 2-[(E)-[[4-(4-bromoanilino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 135606257 |
| Molecular Formula | C19H12BrF6N7O4 |
| Molecular Weight | 596.24 g/mol |
| Exact Mass | 595.00 |
| IUPAC Name | 2-[(E)-[[4-(4-bromoanilino)-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/Nc2nc(Nc3ccc(Br)cc3)nc(OC(C(F)(F)F)C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C19H12BrF6N7O4/c20-10-1-3-11(4-2-10)28-15-29-16(31-17(30-15)37-14(18(21,22)23)19(24,25)26)32-27-8-9-7-12(33(35)36)5-6-13(9)34/h1-8,14,34H,(H2,28,29,30,31,32)/b27-8+ |
| InChIKey | KLLPCUZMLQSOHY-FLUNURKVSA-N |
| XLogP | 5.31 |
| TPSA | 147.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.24 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|