C23H19F6N7O5 — CID 3679615
2-[[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]phenyl]iminomethyl]-4-nitrophenol (PubChem CID 3679615) has the molecular formula C23H19F6N7O5 and a molecular weight of 587.44 g/mol. Its IUPAC name is 2-[[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]phenyl]iminomethyl]-4-nitrophenol.
| Compound Name | 2-[[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]phenyl]iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 3679615 |
| Molecular Formula | C23H19F6N7O5 |
| Molecular Weight | 587.44 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | 2-[[3-[[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]phenyl]iminomethyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/c2cccc(Nc3nc(OC(C(F)(F)F)C(F)(F)F)nc(N4CCOCC4)n3)c2)c1 |
| InChI | InChI=1S/C23H19F6N7O5/c24-22(25,26)18(23(27,28)29)41-21-33-19(32-20(34-21)35-6-8-40-9-7-35)31-15-3-1-2-14(11-15)30-12-13-10-16(36(38)39)4-5-17(13)37/h1-5,10-12,18,37H,6-9H2,(H,31,32,33,34)/b30-12+ |
| InChIKey | LSMITPREXXNIQJ-PNQUVVCRSA-N |
| XLogP | 4.69 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|