C32H30N8O4 — CID 163120534
N,4-dihydroxy-3-[[3-[[4-morpholin-4-yl-6-(N-phenylanilino)-1,3,5-triazin-2-yl]amino]phenyl]iminomethyl]benzeneamine oxide (PubChem CID 163120534) has the molecular formula C32H30N8O4 and a molecular weight of 590.64 g/mol. Its IUPAC name is N,4-dihydroxy-3-[[3-[[4-morpholin-4-yl-6-(N-phenylanilino)-1,3,5-triazin-2-yl]amino]phenyl]iminomethyl]benzeneamine oxide.
| Compound Name | N,4-dihydroxy-3-[[3-[[4-morpholin-4-yl-6-(N-phenylanilino)-1,3,5-triazin-2-yl]amino]phenyl]iminomethyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163120534 |
| Molecular Formula | C32H30N8O4 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | N,4-dihydroxy-3-[[3-[[4-morpholin-4-yl-6-(N-phenylanilino)-1,3,5-triazin-2-yl]amino]phenyl]iminomethyl]benzeneamine oxide |
| SMILES | [O-][NH+](O)c1ccc(O)c(/C=N/c2cccc(Nc3nc(N4CCOCC4)nc(N(c4ccccc4)c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C32H30N8O4/c41-29-15-14-28(40(42)43)20-23(29)22-33-24-8-7-9-25(21-24)34-30-35-31(38-16-18-44-19-17-38)37-32(36-30)39(26-10-3-1-4-11-26)27-12-5-2-6-13-27/h1-15,20-22,40-42H,16-19H2,(H,34,35,36,37)/b33-22+ |
| InChIKey | BJEFREDIHZNCSX-STKMKYKTSA-N |
| XLogP | 4.78 |
| TPSA | 146.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|