C19H18F3N7O2 — CID 136918920
2-methoxy-4-[(Z)-[[4-(methylamino)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 136918920) has the molecular formula C19H18F3N7O2 and a molecular weight of 433.39 g/mol. Its IUPAC name is 2-methoxy-4-[(Z)-[[4-(methylamino)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-methoxy-4-[(Z)-[[4-(methylamino)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136918920 |
| Molecular Formula | C19H18F3N7O2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-methoxy-4-[(Z)-[[4-(methylamino)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | CNc1nc(N/N=C\c2ccc(O)c(OC)c2)nc(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H18F3N7O2/c1-23-16-26-17(25-13-5-3-4-12(9-13)19(20,21)22)28-18(27-16)29-24-10-11-6-7-14(30)15(8-11)31-2/h3-10,30H,1-2H3,(H3,23,25,26,27,28,29)/b24-10- |
| InChIKey | UMGOPBSZFYQBGC-VROXFSQNSA-N |
| XLogP | 3.84 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|