C17H20F3N5 — CID 4099295
4-N,4-N-dimethyl-2-propan-2-yl-6-N-[[2-(trifluoromethyl)phenyl]methylideneamino]pyrimidine-4,6-diamine (PubChem CID 4099295) has the molecular formula C17H20F3N5 and a molecular weight of 351.38 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-propan-2-yl-6-N-[[2-(trifluoromethyl)phenyl]methylideneamino]pyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dimethyl-2-propan-2-yl-6-N-[[2-(trifluoromethyl)phenyl]methylideneamino]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 4099295 |
| Molecular Formula | C17H20F3N5 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-N,4-N-dimethyl-2-propan-2-yl-6-N-[[2-(trifluoromethyl)phenyl]methylideneamino]pyrimidine-4,6-diamine |
| SMILES | CC(C)c1nc(NN=Cc2ccccc2C(F)(F)F)cc(N(C)C)n1 |
| InChI | InChI=1S/C17H20F3N5/c1-11(2)16-22-14(9-15(23-16)25(3)4)24-21-10-12-7-5-6-8-13(12)17(18,19)20/h5-11H,1-4H3,(H,22,23,24) |
| InChIKey | LNFREYHGVINPMI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|