C26H29BrN6O — CID 4589206
6-N-[[1-[2-(4-bromophenoxy)ethyl]indol-3-yl]methylideneamino]-4-N,4-N-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine (PubChem CID 4589206) has the molecular formula C26H29BrN6O and a molecular weight of 521.46 g/mol. Its IUPAC name is 6-N-[[1-[2-(4-bromophenoxy)ethyl]indol-3-yl]methylideneamino]-4-N,4-N-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[[1-[2-(4-bromophenoxy)ethyl]indol-3-yl]methylideneamino]-4-N,4-N-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 4589206 |
| Molecular Formula | C26H29BrN6O |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 6-N-[[1-[2-(4-bromophenoxy)ethyl]indol-3-yl]methylideneamino]-4-N,4-N-dimethyl-2-propan-2-ylpyrimidine-4,6-diamine |
| SMILES | CC(C)c1nc(NN=Cc2cn(CCOc3ccc(Br)cc3)c3ccccc23)cc(N(C)C)n1 |
| InChI | InChI=1S/C26H29BrN6O/c1-18(2)26-29-24(15-25(30-26)32(3)4)31-28-16-19-17-33(23-8-6-5-7-22(19)23)13-14-34-21-11-9-20(27)10-12-21/h5-12,15-18H,13-14H2,1-4H3,(H,29,30,31) |
| InChIKey | NJIPPLGDOOBPQN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|