C16H20ClN5O — CID 136690171
4-chloro-2-[(Z)-[[6-(dimethylamino)-2-propan-2-ylpyrimidin-4-yl]hydrazinylidene]methyl]phenol (PubChem CID 136690171) has the molecular formula C16H20ClN5O and a molecular weight of 333.82 g/mol. Its IUPAC name is 4-chloro-2-[(Z)-[[6-(dimethylamino)-2-propan-2-ylpyrimidin-4-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 4-chloro-2-[(Z)-[[6-(dimethylamino)-2-propan-2-ylpyrimidin-4-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136690171 |
| Molecular Formula | C16H20ClN5O |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-chloro-2-[(Z)-[[6-(dimethylamino)-2-propan-2-ylpyrimidin-4-yl]hydrazinylidene]methyl]phenol |
| SMILES | CC(C)c1nc(N/N=C\c2cc(Cl)ccc2O)cc(N(C)C)n1 |
| InChI | InChI=1S/C16H20ClN5O/c1-10(2)16-19-14(8-15(20-16)22(3)4)21-18-9-11-7-12(17)5-6-13(11)23/h5-10,23H,1-4H3,(H,19,20,21)/b18-9- |
| InChIKey | CHZHVFQQTAISMN-NVMNQCDNSA-N |
| XLogP | 3.47 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|