C19H21Cl2N3O4S — CID 23095152
2,5-dichloro-N-[(Z)-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]benzenesulfonamide (PubChem CID 23095152) has the molecular formula C19H21Cl2N3O4S and a molecular weight of 458.37 g/mol. Its IUPAC name is 2,5-dichloro-N-[(Z)-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[(Z)-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 23095152 |
| Molecular Formula | C19H21Cl2N3O4S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 2,5-dichloro-N-[(Z)-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(/C=N\NS(=O)(=O)c2cc(Cl)ccc2Cl)cc1CN1CCOCC1 |
| InChI | InChI=1S/C19H21Cl2N3O4S/c1-27-18-5-2-14(10-15(18)13-24-6-8-28-9-7-24)12-22-23-29(25,26)19-11-16(20)3-4-17(19)21/h2-5,10-12,23H,6-9,13H2,1H3/b22-12- |
| InChIKey | OOKNANVKDOSBBA-UUYOSTAYSA-N |
| XLogP | 3.15 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|