C19H22FN3O3S2 — CID 1007976
4-fluoro-N-[[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylideneamino]benzenesulfonamide (PubChem CID 1007976) has the molecular formula C19H22FN3O3S2 and a molecular weight of 423.54 g/mol. Its IUPAC name is 4-fluoro-N-[[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 1007976 |
| Molecular Formula | C19H22FN3O3S2 |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-fluoro-N-[[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(C=NNS(=O)(=O)c2ccc(F)cc2)cc1CN1CCSCC1 |
| InChI | InChI=1S/C19H22FN3O3S2/c1-26-19-7-2-15(12-16(19)14-23-8-10-27-11-9-23)13-21-22-28(24,25)18-5-3-17(20)4-6-18/h2-7,12-13,22H,8-11,14H2,1H3 |
| InChIKey | HPSFHLYYXBEUPL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|