C24H20FN3O4S — CID 5431510
4-fluoro-N-[(Z)-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]methylideneamino]benzenesulfonamide (PubChem CID 5431510) has the molecular formula C24H20FN3O4S and a molecular weight of 465.51 g/mol. Its IUPAC name is 4-fluoro-N-[(Z)-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(Z)-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 5431510 |
| Molecular Formula | C24H20FN3O4S |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 4-fluoro-N-[(Z)-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(/C=N\NS(=O)(=O)c2ccc(F)cc2)cc1COc1cccc2cccnc12 |
| InChI | InChI=1S/C24H20FN3O4S/c1-31-22-12-7-17(15-27-28-33(29,30)21-10-8-20(25)9-11-21)14-19(22)16-32-23-6-2-4-18-5-3-13-26-24(18)23/h2-15,28H,16H2,1H3/b27-15- |
| InChIKey | CRLFEPKRSOGAQW-DICXZTSXSA-N |
| XLogP | 4.27 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|