C21H17N5O4 — CID 19580866
(E)-1-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]-N-(4-nitropyrazol-1-yl)methanimine (PubChem CID 19580866) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is (E)-1-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]-N-(4-nitropyrazol-1-yl)methanimine.
| Compound Name | (E)-1-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]-N-(4-nitropyrazol-1-yl)methanimine |
|---|---|
| PubChem CID | 19580866 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (E)-1-[4-methoxy-3-(quinolin-8-yloxymethyl)phenyl]-N-(4-nitropyrazol-1-yl)methanimine |
| SMILES | COc1ccc(/C=N/n2cc([N+](=O)[O-])cn2)cc1COc1cccc2cccnc12 |
| InChI | InChI=1S/C21H17N5O4/c1-29-19-8-7-15(11-23-25-13-18(12-24-25)26(27)28)10-17(19)14-30-20-6-2-4-16-5-3-9-22-21(16)20/h2-13H,14H2,1H3/b23-11+ |
| InChIKey | HOGJPPMTCRWKSQ-FOKLQQMPSA-N |
| XLogP | 3.81 |
| TPSA | 104.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|