C20H16Cl3N3OS — CID 46496624
2,4,6-trichloro-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]aniline (PubChem CID 46496624) has the molecular formula C20H16Cl3N3OS and a molecular weight of 452.79 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 46496624 |
| Molecular Formula | C20H16Cl3N3OS |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 2,4,6-trichloro-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]aniline |
| SMILES | COc1ccc(/C=N/Nc2c(Cl)cc(Cl)cc2Cl)cc1CSc1ccccn1 |
| InChI | InChI=1S/C20H16Cl3N3OS/c1-27-18-6-5-13(8-14(18)12-28-19-4-2-3-7-24-19)11-25-26-20-16(22)9-15(21)10-17(20)23/h2-11,26H,12H2,1H3/b25-11+ |
| InChIKey | OBJBLSYZSBQVRT-OPEKNORGSA-N |
| XLogP | 6.79 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|