C20H16Cl3N5O2S — CID 6881132
4-amino-3,5,6-trichloro-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]pyridine-2-carboxamide (PubChem CID 6881132) has the molecular formula C20H16Cl3N5O2S and a molecular weight of 496.81 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 6881132 |
| Molecular Formula | C20H16Cl3N5O2S |
| Molecular Weight | 496.81 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]methylideneamino]pyridine-2-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)cc1CSc1ccccn1 |
| InChI | InChI=1S/C20H16Cl3N5O2S/c1-30-13-6-5-11(8-12(13)10-31-14-4-2-3-7-25-14)9-26-28-20(29)18-15(21)17(24)16(22)19(23)27-18/h2-9H,10H2,1H3,(H2,24,27)(H,28,29)/b26-9+ |
| InChIKey | MXKHWPGAVXWWCT-JQAMDZJQSA-N |
| XLogP | 5.08 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.81 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|