C13H8Cl4N4O2 — CID 136781547
4-amino-3,5,6-trichloro-N-[(E)-(3-chloro-4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide (PubChem CID 136781547) has the molecular formula C13H8Cl4N4O2 and a molecular weight of 394.05 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-(3-chloro-4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-(3-chloro-4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 136781547 |
| Molecular Formula | C13H8Cl4N4O2 |
| Molecular Weight | 394.05 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-(3-chloro-4-hydroxyphenyl)methylideneamino]pyridine-2-carboxamide |
| SMILES | Nc1c(Cl)c(Cl)nc(C(=O)N/N=C/c2ccc(O)c(Cl)c2)c1Cl |
| InChI | InChI=1S/C13H8Cl4N4O2/c14-6-3-5(1-2-7(6)22)4-19-21-13(23)11-8(15)10(18)9(16)12(17)20-11/h1-4,22H,(H2,18,20)(H,21,23)/b19-4+ |
| InChIKey | RTUKNCSIBYEUNC-RMOCHZDMSA-N |
| XLogP | 3.75 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.05 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|