C14H12Cl3N5O3 — CID 135558225
4-amino-3,5,6-trichloro-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]pyridine-2-carboxamide (PubChem CID 135558225) has the molecular formula C14H12Cl3N5O3 and a molecular weight of 404.64 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 135558225 |
| Molecular Formula | C14H12Cl3N5O3 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]pyridine-2-carboxamide |
| SMILES | Cc1ncc(CO)c(/C=N/NC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)c1O |
| InChI | InChI=1S/C14H12Cl3N5O3/c1-5-12(24)7(6(4-23)2-19-5)3-20-22-14(25)11-8(15)10(18)9(16)13(17)21-11/h2-3,23-24H,4H2,1H3,(H2,18,21)(H,22,25)/b20-3+ |
| InChIKey | YCPNJTFRCKKENE-BIMFAAKUSA-N |
| XLogP | 2.29 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|