C17H17Cl3N4O2 — CID 110527745
4-amino-3,5,6-trichloro-N-[(E)-[4-(2-methylpropoxy)phenyl]methylideneamino]pyridine-2-carboxamide (PubChem CID 110527745) has the molecular formula C17H17Cl3N4O2 and a molecular weight of 415.71 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-[4-(2-methylpropoxy)phenyl]methylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-[4-(2-methylpropoxy)phenyl]methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110527745 |
| Molecular Formula | C17H17Cl3N4O2 |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-[4-(2-methylpropoxy)phenyl]methylideneamino]pyridine-2-carboxamide |
| SMILES | CC(C)COc1ccc(/C=N/NC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl3N4O2/c1-9(2)8-26-11-5-3-10(4-6-11)7-22-24-17(25)15-12(18)14(21)13(19)16(20)23-15/h3-7,9H,8H2,1-2H3,(H2,21,23)(H,24,25)/b22-7+ |
| InChIKey | NFRGBRGFSDUZPB-QPJQQBGISA-N |
| XLogP | 4.42 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|