C22H22BrClN4O3 — CID 19659757
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide (PubChem CID 19659757) has the molecular formula C22H22BrClN4O3 and a molecular weight of 505.80 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 19659757 |
| Molecular Formula | C22H22BrClN4O3 |
| Molecular Weight | 505.80 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2nc(C)c(Br)c2C)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22BrClN4O3/c1-14-22(23)15(2)28(27-14)12-21(29)26-25-11-17-6-9-19(20(10-17)30-3)31-13-16-4-7-18(24)8-5-16/h4-11H,12-13H2,1-3H3,(H,26,29)/b25-11+ |
| InChIKey | XOTTWPWFVVKMJC-OPEKNORGSA-N |
| XLogP | 4.65 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.80 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|