C22H23BrN4O3 — CID 19661509
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 19661509) has the molecular formula C22H23BrN4O3 and a molecular weight of 471.36 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19661509 |
| Molecular Formula | C22H23BrN4O3 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2nc(C)c(Br)c2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H23BrN4O3/c1-15-22(23)16(2)27(26-15)13-21(28)25-24-12-18-9-10-19(20(11-18)29-3)30-14-17-7-5-4-6-8-17/h4-12H,13-14H2,1-3H3,(H,25,28)/b24-12+ |
| InChIKey | IOFYNOXFPXWUOZ-WYMPLXKRSA-N |
| XLogP | 4.00 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|