C30H24ClN3O4 — CID 21212503
N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 21212503) has the molecular formula C30H24ClN3O4 and a molecular weight of 525.99 g/mol. Its IUPAC name is N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 21212503 |
| Molecular Formula | C30H24ClN3O4 |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H24ClN3O4/c1-37-28-16-21(12-15-27(28)38-19-20-10-13-22(31)14-11-20)17-32-33-29(35)18-34-25-8-4-2-6-23(25)30(36)24-7-3-5-9-26(24)34/h2-17H,18-19H2,1H3,(H,33,35)/b32-17+ |
| InChIKey | IYGOPEZJSYWLFA-VTNSRFBWSA-N |
| XLogP | 5.55 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|