C18H19BrN6O3 — CID 19521311
N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide (PubChem CID 19521311) has the molecular formula C18H19BrN6O3 and a molecular weight of 447.29 g/mol. Its IUPAC name is N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19521311 |
| Molecular Formula | C18H19BrN6O3 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-(5-methyl-3-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(Cc2cccc(NC(=O)Cn3nc([N+](=O)[O-])cc3C)c2)c(C)c1Br |
| InChI | InChI=1S/C18H19BrN6O3/c1-11-7-16(25(27)28)22-23(11)10-17(26)20-15-6-4-5-14(8-15)9-24-13(3)18(19)12(2)21-24/h4-8H,9-10H2,1-3H3,(H,20,26) |
| InChIKey | YLHATUIQQZRUNC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|