C20H23BrN6O3 — CID 19528547
N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19528547) has the molecular formula C20H23BrN6O3 and a molecular weight of 475.35 g/mol. Its IUPAC name is N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19528547 |
| Molecular Formula | C20H23BrN6O3 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1nn(Cc2cccc(NC(=O)C(C)n3nc(C)c([N+](=O)[O-])c3C)c2)c(C)c1Br |
| InChI | InChI=1S/C20H23BrN6O3/c1-11-18(21)13(3)25(23-11)10-16-7-6-8-17(9-16)22-20(28)15(5)26-14(4)19(27(29)30)12(2)24-26/h6-9,15H,10H2,1-5H3,(H,22,28) |
| InChIKey | KRMNTWYOMBCRTE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|