C19H21BrN6O3 — CID 19562518
N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-methyl-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 19562518) has the molecular formula C19H21BrN6O3 and a molecular weight of 461.32 g/mol. Its IUPAC name is N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-methyl-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-methyl-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19562518 |
| Molecular Formula | C19H21BrN6O3 |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-[3-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]phenyl]-2-methyl-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1nn(Cc2cccc(NC(=O)C(C)Cn3cc([N+](=O)[O-])cn3)c2)c(C)c1Br |
| InChI | InChI=1S/C19H21BrN6O3/c1-12(9-24-11-17(8-21-24)26(28)29)19(27)22-16-6-4-5-15(7-16)10-25-14(3)18(20)13(2)23-25/h4-8,11-12H,9-10H2,1-3H3,(H,22,27) |
| InChIKey | IDAMLXHTJXXFRE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|