C16H19BrN4O3 — CID 6890412
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 6890412) has the molecular formula C16H19BrN4O3 and a molecular weight of 395.26 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6890412 |
| Molecular Formula | C16H19BrN4O3 |
| Molecular Weight | 395.26 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[(E)-(2,3-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(/C=N/NC(=O)Cn2nc(C)c(Br)c2C)c1OC |
| InChI | InChI=1S/C16H19BrN4O3/c1-10-15(17)11(2)21(20-10)9-14(22)19-18-8-12-6-5-7-13(23-3)16(12)24-4/h5-8H,9H2,1-4H3,(H,19,22)/b18-8+ |
| InChIKey | BZIJMYYKUMVJGR-QGMBQPNBSA-N |
| XLogP | 2.43 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|