C21H23N7O4 — CID 3501240
N-[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide (PubChem CID 3501240) has the molecular formula C21H23N7O4 and a molecular weight of 437.46 g/mol. Its IUPAC name is N-[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | N-[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 3501240 |
| Molecular Formula | C21H23N7O4 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2n[nH]c3c2CCC3)cc1Cn1nc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C21H23N7O4/c1-12-20(28(30)31)13(2)27(26-12)11-15-9-14(7-8-18(15)32-3)10-22-25-21(29)19-16-5-4-6-17(16)23-24-19/h7-10H,4-6,11H2,1-3H3,(H,23,24)(H,25,29) |
| InChIKey | JFNLENXMIFDINS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 140.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|