C18H15BrN6O5 — CID 4198817
5-bromo-2-hydroxy-N-[[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]benzamide (PubChem CID 4198817) has the molecular formula C18H15BrN6O5 and a molecular weight of 475.26 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4198817 |
| Molecular Formula | C18H15BrN6O5 |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[[4-methoxy-3-[(3-nitro-1,2,4-triazol-1-yl)methyl]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccc(C=NNC(=O)c2cc(Br)ccc2O)cc1Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C18H15BrN6O5/c1-30-16-5-2-11(6-12(16)9-24-10-20-18(23-24)25(28)29)8-21-22-17(27)14-7-13(19)3-4-15(14)26/h2-8,10,26H,9H2,1H3,(H,22,27) |
| InChIKey | KQDYPLGPRMJHAM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|