C18H18N6O7 — CID 118491438
3,4,5-trihydroxy-N-[(E)-[4-methoxy-3-[(5-nitro-1,3-dihydro-1,2,4-triazol-2-yl)methyl]phenyl]methylideneamino]benzamide (PubChem CID 118491438) has the molecular formula C18H18N6O7 and a molecular weight of 430.38 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[(E)-[4-methoxy-3-[(5-nitro-1,3-dihydro-1,2,4-triazol-2-yl)methyl]phenyl]methylideneamino]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[(E)-[4-methoxy-3-[(5-nitro-1,3-dihydro-1,2,4-triazol-2-yl)methyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 118491438 |
| Molecular Formula | C18H18N6O7 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 3,4,5-trihydroxy-N-[(E)-[4-methoxy-3-[(5-nitro-1,3-dihydro-1,2,4-triazol-2-yl)methyl]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2cc(O)c(O)c(O)c2)cc1CN1CN=C([N+](=O)[O-])N1 |
| InChI | InChI=1S/C18H18N6O7/c1-31-15-3-2-10(4-12(15)8-23-9-19-18(22-23)24(29)30)7-20-21-17(28)11-5-13(25)16(27)14(26)6-11/h2-7,25-27H,8-9H2,1H3,(H,19,22)(H,21,28)/b20-7+ |
| InChIKey | WQKBKKWWASMMBX-IFRROFPPSA-N |
| XLogP | 0.49 |
| TPSA | 182.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|