C20H21BrN2O2 — CID 44723940
4-bromo-2-hydroxy-N-[(E)-[(E)-2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]benzamide (PubChem CID 44723940) has the molecular formula C20H21BrN2O2 and a molecular weight of 401.30 g/mol. Its IUPAC name is 4-bromo-2-hydroxy-N-[(E)-[(E)-2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]benzamide.
| Compound Name | 4-bromo-2-hydroxy-N-[(E)-[(E)-2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]benzamide |
|---|---|
| PubChem CID | 44723940 |
| Molecular Formula | C20H21BrN2O2 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 4-bromo-2-hydroxy-N-[(E)-[(E)-2-methyl-3-(4-propan-2-ylphenyl)prop-2-enylidene]amino]benzamide |
| SMILES | CC(/C=N/NC(=O)c1ccc(Br)cc1O)=C\c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H21BrN2O2/c1-13(2)16-6-4-15(5-7-16)10-14(3)12-22-23-20(25)18-9-8-17(21)11-19(18)24/h4-13,24H,1-3H3,(H,23,25)/b14-10+,22-12+ |
| InChIKey | ZISTVEKVMPHOIM-HWWCMBFXSA-N |
| XLogP | 5.10 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|